C18H27NO3Si — CID 11809767
N-benzyl-N-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl]hydroxylamine (PubChem CID 11809767) has the molecular formula C18H27NO3Si and a molecular weight of 333.50 g/mol. Its IUPAC name is N-benzyl-N-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl]hydroxylamine.
| Compound Name | N-benzyl-N-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl]hydroxylamine |
|---|---|
| PubChem CID | 11809767 |
| Molecular Formula | C18H27NO3Si |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-benzyl-N-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-ynyl]hydroxylamine |
| SMILES | CC1(C)OC[C@H]([C@@H](C#C[Si](C)(C)C)N(O)Cc2ccccc2)O1 |
| InChI | InChI=1S/C18H27NO3Si/c1-18(2)21-14-17(22-18)16(11-12-23(3,4)5)19(20)13-15-9-7-6-8-10-15/h6-10,16-17,20H,13-14H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | NYLLELYPAHKWAI-IAGOWNOFSA-N |
| XLogP | 3.28 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|