C24H37NO5Si — CID 10884818
(4R,5R)-5-[(S)-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 10884818) has the molecular formula C24H37NO5Si and a molecular weight of 447.65 g/mol. Its IUPAC name is (4R,5R)-5-[(S)-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5R)-5-[(S)-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 10884818 |
| Molecular Formula | C24H37NO5Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (4R,5R)-5-[(S)-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC1(C)O[C@@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2CCC(=O)N2Cc2ccccc2)[C@H](C=O)O1 |
| InChI | InChI=1S/C24H37NO5Si/c1-23(2,3)31(6,7)30-21(22-19(16-26)28-24(4,5)29-22)18-13-14-20(27)25(18)15-17-11-9-8-10-12-17/h8-12,16,18-19,21-22H,13-15H2,1-7H3/t18-,19+,21+,22-/m1/s1 |
| InChIKey | PDUZAJGITGDFRU-XMGTWHOFSA-N |
| XLogP | 4.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|