C34H49NO8Si — CID 10817769
ethyl (4S,5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4-trimethylsilyloxypentanoate (PubChem CID 10817769) has the molecular formula C34H49NO8Si and a molecular weight of 627.85 g/mol. Its IUPAC name is ethyl (4S,5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4-trimethylsilyloxypentanoate.
| Compound Name | ethyl (4S,5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4-trimethylsilyloxypentanoate |
|---|---|
| PubChem CID | 10817769 |
| Molecular Formula | C34H49NO8Si |
| Molecular Weight | 627.85 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | ethyl (4S,5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4-trimethylsilyloxypentanoate |
| SMILES | CCOC(=O)C(=O)C[C@H](O[Si](C)(C)C)[C@H]([C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H49NO8Si/c1-9-38-32(37)26(36)20-27(43-44(6,7)8)29(31-30(41-34(4,5)42-31)28-23-39-33(2,3)40-28)35(21-24-16-12-10-13-17-24)22-25-18-14-11-15-19-25/h10-19,27-31H,9,20-23H2,1-8H3/t27-,28+,29+,30+,31+/m0/s1 |
| InChIKey | XZCIBPCIPRTDDA-SIMGMAISSA-N |
| XLogP | 5.47 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.85 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|