C32H41NO7 — CID 10554721
ethyl (5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidene-4-oxopentanoate (PubChem CID 10554721) has the molecular formula C32H41NO7 and a molecular weight of 551.68 g/mol. Its IUPAC name is ethyl (5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidene-4-oxopentanoate.
| Compound Name | ethyl (5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidene-4-oxopentanoate |
|---|---|
| PubChem CID | 10554721 |
| Molecular Formula | C32H41NO7 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | ethyl (5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidene-4-oxopentanoate |
| SMILES | C=C(CC(=O)[C@H]([C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1)N(Cc1ccccc1)Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C32H41NO7/c1-7-36-30(35)22(2)18-25(34)27(29-28(39-32(5,6)40-29)26-21-37-31(3,4)38-26)33(19-23-14-10-8-11-15-23)20-24-16-12-9-13-17-24/h8-17,26-29H,2,7,18-21H2,1,3-6H3/t26-,27-,28-,29-/m1/s1 |
| InChIKey | XFFNTNHSUWFGJM-CXDXLJMYSA-N |
| XLogP | 4.81 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|