C35H51NO7Si — CID 10603988
ethyl (4S,5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidene-4-trimethylsilyloxypentanoate (PubChem CID 10603988) has the molecular formula C35H51NO7Si and a molecular weight of 625.88 g/mol. Its IUPAC name is ethyl (4S,5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidene-4-trimethylsilyloxypentanoate.
| Compound Name | ethyl (4S,5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidene-4-trimethylsilyloxypentanoate |
|---|---|
| PubChem CID | 10603988 |
| Molecular Formula | C35H51NO7Si |
| Molecular Weight | 625.88 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | ethyl (4S,5S)-5-(dibenzylamino)-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidene-4-trimethylsilyloxypentanoate |
| SMILES | C=C(C[C@H](O[Si](C)(C)C)[C@H]([C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1)N(Cc1ccccc1)Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C35H51NO7Si/c1-10-38-33(37)25(2)21-28(43-44(7,8)9)30(32-31(41-35(5,6)42-32)29-24-39-34(3,4)40-29)36(22-26-17-13-11-14-18-26)23-27-19-15-12-16-20-27/h11-20,28-32H,2,10,21-24H2,1,3-9H3/t28-,29+,30+,31+,32+/m0/s1 |
| InChIKey | LHLKFHSZZCQLIP-SMPJQSMZSA-N |
| XLogP | 6.46 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.88 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|