C34H45NO7Si — CID 11786801
(4R,5S)-3-[(2S,3R)-2-[(2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dioxaspiro[4.5]decan-3-yl]-5-oxooxolan-3-yl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 11786801) has the molecular formula C34H45NO7Si and a molecular weight of 607.82 g/mol. Its IUPAC name is (4R,5S)-3-[(2S,3R)-2-[(2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dioxaspiro[4.5]decan-3-yl]-5-oxooxolan-3-yl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(2S,3R)-2-[(2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dioxaspiro[4.5]decan-3-yl]-5-oxooxolan-3-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11786801 |
| Molecular Formula | C34H45NO7Si |
| Molecular Weight | 607.82 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | (4R,5S)-3-[(2S,3R)-2-[(2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dioxaspiro[4.5]decan-3-yl]-5-oxooxolan-3-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1OC2(CCCCC2)O[C@H]1[C@H]1OC(=O)C[C@H]1N1C(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C34H45NO7Si/c1-33(2,3)43(4,5)38-22-26-31(42-34(41-26)19-13-8-14-20-34)30-25(21-27(36)39-30)35-28(23-15-9-6-10-16-23)29(40-32(35)37)24-17-11-7-12-18-24/h6-7,9-12,15-18,25-26,28-31H,8,13-14,19-22H2,1-5H3/t25-,26+,28-,29+,30+,31-/m1/s1 |
| InChIKey | XAGMAOCFRSHATJ-KMBZMPAASA-N |
| XLogP | 7.07 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.82 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|