C32H49NO4Si — CID 11353215
methyl (2S,3R)-3-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methylpentyl]oxolane-2-carboxylate (PubChem CID 11353215) has the molecular formula C32H49NO4Si and a molecular weight of 539.83 g/mol. Its IUPAC name is methyl (2S,3R)-3-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methylpentyl]oxolane-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methylpentyl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 11353215 |
| Molecular Formula | C32H49NO4Si |
| Molecular Weight | 539.83 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | methyl (2S,3R)-3-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methylpentyl]oxolane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OCC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H49NO4Si/c1-24(2)21-28(33(22-25-15-11-9-12-16-25)23-26-17-13-10-14-18-26)29(37-38(7,8)32(3,4)5)27-19-20-36-30(27)31(34)35-6/h9-18,24,27-30H,19-23H2,1-8H3/t27-,28-,29-,30-/m0/s1 |
| InChIKey | YTDBEOZLXZKQGB-KRCBVYEFSA-N |
| XLogP | 7.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.83 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|