C34H41NO13 — CID 10532485
methyl (2R,4S,5R,6R)-2,4-diacetyloxy-5-(dibenzylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 10532485) has the molecular formula C34H41NO13 and a molecular weight of 671.70 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-2,4-diacetyloxy-5-(dibenzylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-2,4-diacetyloxy-5-(dibenzylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10532485 |
| Molecular Formula | C34H41NO13 |
| Molecular Weight | 671.70 g/mol |
| Exact Mass | 671.26 |
| IUPAC Name | methyl (2R,4S,5R,6R)-2,4-diacetyloxy-5-(dibenzylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC(C)=O)C[C@H](OC(C)=O)[C@@H](N(Cc2ccccc2)Cc2ccccc2)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C34H41NO13/c1-21(36)43-20-29(45-23(3)38)31(46-24(4)39)32-30(28(44-22(2)37)17-34(48-32,33(41)42-6)47-25(5)40)35(18-26-13-9-7-10-14-26)19-27-15-11-8-12-16-27/h7-16,28-32H,17-20H2,1-6H3/t28-,29+,30+,31+,32+,34-/m0/s1 |
| InChIKey | XCAJDGMOKUDPSA-POZLCQPYSA-N |
| XLogP | 2.64 |
| TPSA | 170.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|