C30H39NO8 — CID 11103514
methyl (2S,3R)-3-(dibenzylamino)-2-methoxy-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate (PubChem CID 11103514) has the molecular formula C30H39NO8 and a molecular weight of 541.64 g/mol. Its IUPAC name is methyl (2S,3R)-3-(dibenzylamino)-2-methoxy-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate.
| Compound Name | methyl (2S,3R)-3-(dibenzylamino)-2-methoxy-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate |
|---|---|
| PubChem CID | 11103514 |
| Molecular Formula | C30H39NO8 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | methyl (2S,3R)-3-(dibenzylamino)-2-methoxy-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate |
| SMILES | COC(=O)[C@@H](OC)[C@@H]([C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H39NO8/c1-29(2)36-24-22(35-28-26(25(24)37-29)38-30(3,4)39-28)21(23(33-5)27(32)34-6)31(17-19-13-9-7-10-14-19)18-20-15-11-8-12-16-20/h7-16,21-26,28H,17-18H2,1-6H3/t21-,22-,23+,24+,25+,26-,28-/m1/s1 |
| InChIKey | FAQYKSWDOQFOQQ-SFQOYNLYSA-N |
| XLogP | 3.64 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |