C23H37NO4Si — CID 135012517
(5S,6R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]piperidin-2-one (PubChem CID 135012517) has the molecular formula C23H37NO4Si and a molecular weight of 419.64 g/mol. Its IUPAC name is (5S,6R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]piperidin-2-one.
| Compound Name | (5S,6R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]piperidin-2-one |
|---|---|
| PubChem CID | 135012517 |
| Molecular Formula | C23H37NO4Si |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | (5S,6R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]piperidin-2-one |
| SMILES | CC1(C)OC[C@H]([C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC(=O)N2Cc2ccccc2)O1 |
| InChI | InChI=1S/C23H37NO4Si/c1-22(2,3)29(6,7)28-18-13-14-20(25)24(15-17-11-9-8-10-12-17)21(18)19-16-26-23(4,5)27-19/h8-12,18-19,21H,13-16H2,1-7H3/t18-,19+,21-/m0/s1 |
| InChIKey | YGDYSNGAFOYPLN-ZVDOUQERSA-N |
| XLogP | 4.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|