C27H43NO4Si — CID 11317461
N-benzyl-N-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-yl]acetamide (PubChem CID 11317461) has the molecular formula C27H43NO4Si and a molecular weight of 473.73 g/mol. Its IUPAC name is N-benzyl-N-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-yl]acetamide.
| Compound Name | N-benzyl-N-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 11317461 |
| Molecular Formula | C27H43NO4Si |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | N-benzyl-N-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-yl]acetamide |
| SMILES | C=CCC([C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@H]1C=C)N(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C27H43NO4Si/c1-11-16-22(28(20(3)29)19-21-17-14-13-15-18-21)24(32-33(9,10)26(4,5)6)25-23(12-2)30-27(7,8)31-25/h11-15,17-18,22-25H,1-2,16,19H2,3-10H3/t22?,23-,24-,25-/m0/s1 |
| InChIKey | NGIMNZMNDKZHMQ-ZDZYZNPZSA-N |
| XLogP | 6.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|