C20H25NO3 — CID 11045666
N-[(3aS,4S,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]-N-benzylacetamide (PubChem CID 11045666) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is N-[(3aS,4S,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]-N-benzylacetamide.
| Compound Name | N-[(3aS,4S,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]-N-benzylacetamide |
|---|---|
| PubChem CID | 11045666 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(3aS,4S,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]-N-benzylacetamide |
| SMILES | C=CC1=C[C@H]2OC(C)(C)O[C@H]2[C@@H](N(Cc2ccccc2)C(C)=O)C1 |
| InChI | InChI=1S/C20H25NO3/c1-5-15-11-17(19-18(12-15)23-20(3,4)24-19)21(14(2)22)13-16-9-7-6-8-10-16/h5-10,12,17-19H,1,11,13H2,2-4H3/t17-,18+,19-/m0/s1 |
| InChIKey | SMUUKHHQOSPQHM-OTWHNJEPSA-N |
| XLogP | 3.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |