C18H25NO3 — CID 134836022
(Z,4R)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylbut-2-enal (PubChem CID 134836022) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (Z,4R)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylbut-2-enal.
| Compound Name | (Z,4R)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylbut-2-enal |
|---|---|
| PubChem CID | 134836022 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (Z,4R)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylbut-2-enal |
| SMILES | C/C(=C/C=O)[C@H]([C@H]1COC(C)(C)O1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H25NO3/c1-14(10-11-20)17(16-13-21-18(2,3)22-16)19(4)12-15-8-6-5-7-9-15/h5-11,16-17H,12-13H2,1-4H3/b14-10-/t16-,17-/m1/s1 |
| InChIKey | LBGJEMFPDKECPS-QYRJGMMTSA-N |
| XLogP | 2.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|