C34H51NO7Si — CID 71613401
benzyl N-benzyl-N-[(1S)-1-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]carbamate (PubChem CID 71613401) has the molecular formula C34H51NO7Si and a molecular weight of 613.87 g/mol. Its IUPAC name is benzyl N-benzyl-N-[(1S)-1-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]carbamate.
| Compound Name | benzyl N-benzyl-N-[(1S)-1-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 71613401 |
| Molecular Formula | C34H51NO7Si |
| Molecular Weight | 613.87 g/mol |
| Exact Mass | 613.34 |
| IUPAC Name | benzyl N-benzyl-N-[(1S)-1-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]carbamate |
| SMILES | C=CC[C@@H]([C@@H]1OC(C)(C)O[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)OCOC)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H51NO7Si/c1-10-17-28(35(22-26-18-13-11-14-19-26)32(36)38-23-27-20-15-12-16-21-27)30-31(42-34(5,6)41-30)29(39-25-37-7)24-40-43(8,9)33(2,3)4/h10-16,18-21,28-31H,1,17,22-25H2,2-9H3/t28-,29+,30-,31+/m0/s1 |
| InChIKey | PUAQWQFZVLMZPZ-XFBWMNOSSA-N |
| XLogP | 7.30 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.87 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|