C28H49NO6Si2 — CID 134831444
benzyl (3aS,5R,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate (PubChem CID 134831444) has the molecular formula C28H49NO6Si2 and a molecular weight of 551.87 g/mol. Its IUPAC name is benzyl (3aS,5R,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (3aS,5R,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 134831444 |
| Molecular Formula | C28H49NO6Si2 |
| Molecular Weight | 551.87 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | benzyl (3aS,5R,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
| SMILES | CC1(C)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)N(C(=O)OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C28H49NO6Si2/c1-26(2,3)36(9,10)32-19-21-22(35-37(11,12)27(4,5)6)23-24(34-28(7,8)33-23)29(21)25(30)31-18-20-16-14-13-15-17-20/h13-17,21-24H,18-19H2,1-12H3/t21-,22-,23+,24+/m1/s1 |
| InChIKey | ZBCFAXLFDBIWSZ-LWSSLDFYSA-N |
| XLogP | 6.90 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.87 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|