C28H49NO5Si2 — CID 134831445
benzyl (2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-5-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 134831445) has the molecular formula C28H49NO5Si2 and a molecular weight of 535.87 g/mol. Its IUPAC name is benzyl (2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-5-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-5-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134831445 |
| Molecular Formula | C28H49NO5Si2 |
| Molecular Weight | 535.87 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | benzyl (2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-5-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H49NO5Si2/c1-12-16-22-24(30)25(34-36(10,11)28(5,6)7)23(20-33-35(8,9)27(2,3)4)29(22)26(31)32-19-21-17-14-13-15-18-21/h12-15,17-18,22-25,30H,1,16,19-20H2,2-11H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | GLYDDCWJHDJEFY-ZGFBMJKBSA-N |
| XLogP | 6.73 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.87 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|