C19H27NO5 — CID 134847757
benzyl (3aS,6S,6aS)-2,2-diethyl-6-(2-hydroxyethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate (PubChem CID 134847757) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is benzyl (3aS,6S,6aS)-2,2-diethyl-6-(2-hydroxyethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate.
| Compound Name | benzyl (3aS,6S,6aS)-2,2-diethyl-6-(2-hydroxyethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 134847757 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | benzyl (3aS,6S,6aS)-2,2-diethyl-6-(2-hydroxyethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate |
| SMILES | CCC1(CC)O[C@@H]2[C@H](CCO)OC[C@@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO5/c1-3-19(4-2)20(15-13-23-16(10-11-21)17(15)25-19)18(22)24-12-14-8-6-5-7-9-14/h5-9,15-17,21H,3-4,10-13H2,1-2H3/t15-,16-,17-/m0/s1 |
| InChIKey | LWJXICWCICOROV-ULQDDVLXSA-N |
| XLogP | 2.69 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |