C24H37NO6Si — CID 24767489
(1R,2R,6S,9R,11R)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-11-(phenylmethoxymethyl)-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one (PubChem CID 24767489) has the molecular formula C24H37NO6Si and a molecular weight of 463.65 g/mol. Its IUPAC name is (1R,2R,6S,9R,11R)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-11-(phenylmethoxymethyl)-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one.
| Compound Name | (1R,2R,6S,9R,11R)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-11-(phenylmethoxymethyl)-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one |
|---|---|
| PubChem CID | 24767489 |
| Molecular Formula | C24H37NO6Si |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | (1R,2R,6S,9R,11R)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-11-(phenylmethoxymethyl)-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one |
| SMILES | CN1C(=O)O[C@@H]2CO[C@@H]3C[C@@](COCc4ccccc4)(CO[Si](C)(C)C(C)(C)C)O[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C24H37NO6Si/c1-23(2,3)32(5,6)29-16-24(15-27-13-17-10-8-7-9-11-17)12-18-21(31-24)20-19(14-28-18)30-22(26)25(20)4/h7-11,18-21H,12-16H2,1-6H3/t18-,19-,20-,21+,24-/m1/s1 |
| InChIKey | ZJQKJQXYCOGBSG-WSAMWWOZSA-N |
| XLogP | 3.97 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|