C31H45NO5Si — CID 101386811
(5R,6R,7R,8S,8aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-7,8-bis(phenylmethoxymethyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 101386811) has the molecular formula C31H45NO5Si and a molecular weight of 539.79 g/mol. Its IUPAC name is (5R,6R,7R,8S,8aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-7,8-bis(phenylmethoxymethyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (5R,6R,7R,8S,8aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-7,8-bis(phenylmethoxymethyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 101386811 |
| Molecular Formula | C31H45NO5Si |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | (5R,6R,7R,8S,8aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-7,8-bis(phenylmethoxymethyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | C[C@@H]1[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](COCc2ccccc2)[C@H](COCc2ccccc2)[C@@H]2COC(=O)N12 |
| InChI | InChI=1S/C31H45NO5Si/c1-23-26(21-37-38(5,6)31(2,3)4)27(19-34-17-24-13-9-7-10-14-24)28(29-22-36-30(33)32(23)29)20-35-18-25-15-11-8-12-16-25/h7-16,23,26-29H,17-22H2,1-6H3/t23-,26+,27+,28+,29+/m1/s1 |
| InChIKey | SFBGBVVNVHMNJQ-CABIFEKBSA-N |
| XLogP | 6.51 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|