C43H59NO4Si — CID 11578412
tert-butyl (2R,5S)-2-[(4S)-1-[tert-butyl(diphenyl)silyl]oxyoct-7-en-4-yl]-2-ethenyl-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 11578412) has the molecular formula C43H59NO4Si and a molecular weight of 682.03 g/mol. Its IUPAC name is tert-butyl (2R,5S)-2-[(4S)-1-[tert-butyl(diphenyl)silyl]oxyoct-7-en-4-yl]-2-ethenyl-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-2-[(4S)-1-[tert-butyl(diphenyl)silyl]oxyoct-7-en-4-yl]-2-ethenyl-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11578412 |
| Molecular Formula | C43H59NO4Si |
| Molecular Weight | 682.03 g/mol |
| Exact Mass | 681.42 |
| IUPAC Name | tert-butyl (2R,5S)-2-[(4S)-1-[tert-butyl(diphenyl)silyl]oxyoct-7-en-4-yl]-2-ethenyl-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCC[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@]1(C=C)CC[C@@H](COCc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C43H59NO4Si/c1-9-11-24-36(25-21-32-47-49(42(6,7)8,38-26-17-13-18-27-38)39-28-19-14-20-29-39)43(10-2)31-30-37(44(43)40(45)48-41(3,4)5)34-46-33-35-22-15-12-16-23-35/h9-10,12-20,22-23,26-29,36-37H,1-2,11,21,24-25,30-34H2,3-8H3/t36-,37-,43-/m0/s1 |
| InChIKey | JUSATGRKNSKERQ-QJODFBJXSA-N |
| XLogP | 9.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.03 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|