C41H55NO4Si — CID 101394724
tert-butyl (2S,5S,6S)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]dec-9-ene-1-carboxylate (PubChem CID 101394724) has the molecular formula C41H55NO4Si and a molecular weight of 653.98 g/mol. Its IUPAC name is tert-butyl (2S,5S,6S)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]dec-9-ene-1-carboxylate.
| Compound Name | tert-butyl (2S,5S,6S)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]dec-9-ene-1-carboxylate |
|---|---|
| PubChem CID | 101394724 |
| Molecular Formula | C41H55NO4Si |
| Molecular Weight | 653.98 g/mol |
| Exact Mass | 653.39 |
| IUPAC Name | tert-butyl (2S,5S,6S)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]dec-9-ene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](COCc2ccccc2)CC[C@]12C=CCC[C@H]2CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H55NO4Si/c1-39(2,3)46-38(43)42-35(32-44-31-33-19-10-7-11-20-33)27-29-41(42)28-17-16-21-34(41)22-18-30-45-47(40(4,5)6,36-23-12-8-13-24-36)37-25-14-9-15-26-37/h7-15,17,19-20,23-26,28,34-35H,16,18,21-22,27,29-32H2,1-6H3/t34-,35-,41-/m0/s1 |
| InChIKey | RFEQPWQACSBZCG-FRHGLMEDSA-N |
| XLogP | 8.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.98 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|