C38H59NO3Si — CID 24851427
tert-butyl (2R,3R,5S)-5-[[dimethyl(phenyl)silyl]methyl]-2-prop-2-enyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate (PubChem CID 24851427) has the molecular formula C38H59NO3Si and a molecular weight of 605.98 g/mol. Its IUPAC name is tert-butyl (2R,3R,5S)-5-[[dimethyl(phenyl)silyl]methyl]-2-prop-2-enyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,5S)-5-[[dimethyl(phenyl)silyl]methyl]-2-prop-2-enyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 24851427 |
| Molecular Formula | C38H59NO3Si |
| Molecular Weight | 605.98 g/mol |
| Exact Mass | 605.43 |
| IUPAC Name | tert-butyl (2R,3R,5S)-5-[[dimethyl(phenyl)silyl]methyl]-2-prop-2-enyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1[C@H](O[C@@H](C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)C[C@@H](C[Si](C)(C)c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H59NO3Si/c1-14-18-34-35(41-28(8)36-32(26(4)5)21-29(25(2)3)22-33(36)27(6)7)23-30(39(34)37(40)42-38(9,10)11)24-43(12,13)31-19-16-15-17-20-31/h14-17,19-22,25-28,30,34-35H,1,18,23-24H2,2-13H3/t28-,30-,34+,35+/m0/s1 |
| InChIKey | GNKKUEBPLWRNML-RTHVFAANSA-N |
| XLogP | 10.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.98 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|