C45H49NO6Si — CID 134850317
(1R,8R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,7,8-tris(phenylmethoxy)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 134850317) has the molecular formula C45H49NO6Si and a molecular weight of 727.97 g/mol. Its IUPAC name is (1R,8R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,7,8-tris(phenylmethoxy)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (1R,8R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,7,8-tris(phenylmethoxy)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 134850317 |
| Molecular Formula | C45H49NO6Si |
| Molecular Weight | 727.97 g/mol |
| Exact Mass | 727.33 |
| IUPAC Name | (1R,8R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,7,8-tris(phenylmethoxy)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1OC(=O)N2CC(OCc3ccccc3)C(OCc3ccccc3)[C@H](OCc3ccccc3)C12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H49NO6Si/c1-45(2,3)53(37-25-15-7-16-26-37,38-27-17-8-18-28-38)51-33-40-41-43(50-32-36-23-13-6-14-24-36)42(49-31-35-21-11-5-12-22-35)39(29-46(41)44(47)52-40)48-30-34-19-9-4-10-20-34/h4-28,39-43H,29-33H2,1-3H3/t39?,40-,41?,42?,43+/m0/s1 |
| InChIKey | HQOXFMMJRNXAKN-JUCMAUGWSA-N |
| XLogP | 7.52 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.97 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|