C31H53NO6Si2 — CID 134923928
benzyl (3aR,4R,6R,7S,7aS)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 134923928) has the molecular formula C31H53NO6Si2 and a molecular weight of 591.94 g/mol. Its IUPAC name is benzyl (3aR,4R,6R,7S,7aS)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl (3aR,4R,6R,7S,7aS)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 134923928 |
| Molecular Formula | C31H53NO6Si2 |
| Molecular Weight | 591.94 g/mol |
| Exact Mass | 591.34 |
| IUPAC Name | benzyl (3aR,4R,6R,7S,7aS)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | C=CC[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H53NO6Si2/c1-14-18-23-24(37-39(10,11)29(2,3)4)25-26(36-31(8,9)35-25)27(38-40(12,13)30(5,6)7)32(23)28(33)34-21-22-19-16-15-17-20-22/h14-17,19-20,23-27H,1,18,21H2,2-13H3/t23-,24+,25-,26-,27-/m1/s1 |
| InChIKey | QIALLVMTMIRKFY-UDLFFNGBSA-N |
| XLogP | 7.84 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.94 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|