C29H49NO2Si — CID 11027109
[(6E,7R,8R,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-yl]oxy-triethylsilane (PubChem CID 11027109) has the molecular formula C29H49NO2Si and a molecular weight of 471.80 g/mol. Its IUPAC name is [(6E,7R,8R,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-yl]oxy-triethylsilane.
| Compound Name | [(6E,7R,8R,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11027109 |
| Molecular Formula | C29H49NO2Si |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 471.35 |
| IUPAC Name | [(6E,7R,8R,8aS)-8-methyl-6-[(2R)-2-methylhexylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-yl]oxy-triethylsilane |
| SMILES | CCCC[C@@H](C)/C=C1\CN2CCC[C@H]2[C@@](C)(OCc2ccccc2)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H49NO2Si/c1-7-11-16-24(5)21-26-22-30-20-15-19-27(30)29(6,31-23-25-17-13-12-14-18-25)28(26)32-33(8-2,9-3)10-4/h12-14,17-18,21,24,27-28H,7-11,15-16,19-20,22-23H2,1-6H3/b26-21+/t24-,27+,28-,29-/m1/s1 |
| InChIKey | LMVSFDRHDKAGBS-SZBRTXJJSA-N |
| XLogP | 7.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|