C26H38INO4 — CID 15119749
(E,2R,3R,7R,8Z)-8-[(7R,8R,8aS)-7-hydroxy-8-methyl-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-6-ylidene]-8-iodo-4,7-dimethyloct-4-ene-2,3-diol (PubChem CID 15119749) has the molecular formula C26H38INO4 and a molecular weight of 555.50 g/mol. Its IUPAC name is (E,2R,3R,7R,8Z)-8-[(7R,8R,8aS)-7-hydroxy-8-methyl-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-6-ylidene]-8-iodo-4,7-dimethyloct-4-ene-2,3-diol.
| Compound Name | (E,2R,3R,7R,8Z)-8-[(7R,8R,8aS)-7-hydroxy-8-methyl-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-6-ylidene]-8-iodo-4,7-dimethyloct-4-ene-2,3-diol |
|---|---|
| PubChem CID | 15119749 |
| Molecular Formula | C26H38INO4 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | (E,2R,3R,7R,8Z)-8-[(7R,8R,8aS)-7-hydroxy-8-methyl-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-6-ylidene]-8-iodo-4,7-dimethyloct-4-ene-2,3-diol |
| SMILES | C/C(=C\C[C@@H](C)/C(I)=C1\CN2CCC[C@H]2[C@@](C)(OCc2ccccc2)[C@@H]1O)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C26H38INO4/c1-17(12-13-18(2)24(30)19(3)29)23(27)21-15-28-14-8-11-22(28)26(4,25(21)31)32-16-20-9-6-5-7-10-20/h5-7,9-10,13,17,19,22,24-25,29-31H,8,11-12,14-16H2,1-4H3/b18-13+,23-21-/t17-,19-,22+,24-,25-,26-/m1/s1 |
| InChIKey | WRGZQKOIYHMRBO-XEHNEGFCSA-N |
| XLogP | 4.20 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|