C29H43NO4 — CID 11812703
(6E,7R,8R,8aS)-8-methyl-6-[(E,2R)-2-methyl-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-4-enylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol (PubChem CID 11812703) has the molecular formula C29H43NO4 and a molecular weight of 469.67 g/mol. Its IUPAC name is (6E,7R,8R,8aS)-8-methyl-6-[(E,2R)-2-methyl-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-4-enylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol.
| Compound Name | (6E,7R,8R,8aS)-8-methyl-6-[(E,2R)-2-methyl-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-4-enylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol |
|---|---|
| PubChem CID | 11812703 |
| Molecular Formula | C29H43NO4 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | (6E,7R,8R,8aS)-8-methyl-6-[(E,2R)-2-methyl-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-4-enylidene]-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol |
| SMILES | C/C(=C\C[C@@H](C)/C=C1\CN2CCC[C@H]2[C@@](C)(OCc2ccccc2)[C@@H]1O)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C29H43NO4/c1-20(14-15-21(2)26-22(3)33-28(4,5)34-26)17-24-18-30-16-10-13-25(30)29(6,27(24)31)32-19-23-11-8-7-9-12-23/h7-9,11-12,15,17,20,22,25-27,31H,10,13-14,16,18-19H2,1-6H3/b21-15+,24-17+/t20-,22-,25+,26-,27-,29-/m1/s1 |
| InChIKey | NBEYUXAMMHEBOX-RCVZGMODSA-N |
| XLogP | 5.24 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|