C29H42INO4 — CID 15286464
(6Z,7R,8R,8aS)-6-[(E,2R)-1-iodo-2-methyl-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-4-enylidene]-8-methyl-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol (PubChem CID 15286464) has the molecular formula C29H42INO4 and a molecular weight of 595.56 g/mol. Its IUPAC name is (6Z,7R,8R,8aS)-6-[(E,2R)-1-iodo-2-methyl-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-4-enylidene]-8-methyl-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol.
| Compound Name | (6Z,7R,8R,8aS)-6-[(E,2R)-1-iodo-2-methyl-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-4-enylidene]-8-methyl-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol |
|---|---|
| PubChem CID | 15286464 |
| Molecular Formula | C29H42INO4 |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | (6Z,7R,8R,8aS)-6-[(E,2R)-1-iodo-2-methyl-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-4-enylidene]-8-methyl-8-phenylmethoxy-1,2,3,5,7,8a-hexahydroindolizin-7-ol |
| SMILES | C/C(=C\C[C@@H](C)/C(I)=C1\CN2CCC[C@H]2[C@@](C)(OCc2ccccc2)[C@@H]1O)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C29H42INO4/c1-19(14-15-20(2)26-21(3)34-28(4,5)35-26)25(30)23-17-31-16-10-13-24(31)29(6,27(23)32)33-18-22-11-8-7-9-12-22/h7-9,11-12,15,19,21,24,26-27,32H,10,13-14,16-18H2,1-6H3/b20-15+,25-23-/t19-,21-,24+,26-,27-,29-/m1/s1 |
| InChIKey | BOYDKEXNAFXCCJ-XCDGYGDJSA-N |
| XLogP | 6.00 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|