C20H29NO4 — CID 59100006
(7S,9R,9aR,9bS)-2,2-dimethyl-7-(2-phenylmethoxyethyl)-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizin-9-ol (PubChem CID 59100006) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is (7S,9R,9aR,9bS)-2,2-dimethyl-7-(2-phenylmethoxyethyl)-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizin-9-ol.
| Compound Name | (7S,9R,9aR,9bS)-2,2-dimethyl-7-(2-phenylmethoxyethyl)-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizin-9-ol |
|---|---|
| PubChem CID | 59100006 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | (7S,9R,9aR,9bS)-2,2-dimethyl-7-(2-phenylmethoxyethyl)-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizin-9-ol |
| SMILES | CC1(C)OC2CN3C[C@@H](CCOCc4ccccc4)C[C@@H](O)[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C20H29NO4/c1-20(2)24-17-12-21-11-15(10-16(22)18(21)19(17)25-20)8-9-23-13-14-6-4-3-5-7-14/h3-7,15-19,22H,8-13H2,1-2H3/t15-,16+,17?,18+,19+/m0/s1 |
| InChIKey | NCKLVJOBRSIFMB-SODMIOSESA-N |
| XLogP | 2.18 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|