C30H42N2O4 — CID 15119743
2-[(2S)-2-[(E,2R,3R,6R)-3-hydroxy-6-methyl-2-phenylmethoxy-9-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]dec-8-en-4-yn-2-yl]pyrrolidin-1-yl]acetonitrile (PubChem CID 15119743) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is 2-[(2S)-2-[(E,2R,3R,6R)-3-hydroxy-6-methyl-2-phenylmethoxy-9-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]dec-8-en-4-yn-2-yl]pyrrolidin-1-yl]acetonitrile.
| Compound Name | 2-[(2S)-2-[(E,2R,3R,6R)-3-hydroxy-6-methyl-2-phenylmethoxy-9-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]dec-8-en-4-yn-2-yl]pyrrolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 15119743 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 2-[(2S)-2-[(E,2R,3R,6R)-3-hydroxy-6-methyl-2-phenylmethoxy-9-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]dec-8-en-4-yn-2-yl]pyrrolidin-1-yl]acetonitrile |
| SMILES | C/C(=C\C[C@@H](C)C#C[C@@H](O)[C@](C)(OCc1ccccc1)[C@@H]1CCCN1CC#N)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C30H42N2O4/c1-22(14-16-23(2)28-24(3)35-29(4,5)36-28)15-17-27(33)30(6,26-13-10-19-32(26)20-18-31)34-21-25-11-8-7-9-12-25/h7-9,11-12,16,22,24,26-28,33H,10,13-14,19-21H2,1-6H3/b23-16+/t22-,24-,26+,27-,28-,30-/m1/s1 |
| InChIKey | SUJNINMETWVRPX-JPPPEYJQSA-N |
| XLogP | 4.83 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|