C18H26N2O3 — CID 11109951
2-[(2S)-2-[(2R)-1,1-dimethoxy-2-phenylmethoxypropan-2-yl]pyrrolidin-1-yl]acetonitrile (PubChem CID 11109951) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[(2S)-2-[(2R)-1,1-dimethoxy-2-phenylmethoxypropan-2-yl]pyrrolidin-1-yl]acetonitrile.
| Compound Name | 2-[(2S)-2-[(2R)-1,1-dimethoxy-2-phenylmethoxypropan-2-yl]pyrrolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 11109951 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-[(2S)-2-[(2R)-1,1-dimethoxy-2-phenylmethoxypropan-2-yl]pyrrolidin-1-yl]acetonitrile |
| SMILES | COC(OC)[C@](C)(OCc1ccccc1)[C@@H]1CCCN1CC#N |
| InChI | InChI=1S/C18H26N2O3/c1-18(17(21-2)22-3,16-10-7-12-20(16)13-11-19)23-14-15-8-5-4-6-9-15/h4-6,8-9,16-17H,7,10,12-14H2,1-3H3/t16-,18+/m0/s1 |
| InChIKey | OWHWSCIKAUMJKE-FUHWJXTLSA-N |
| XLogP | 2.57 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|