C24H37NO7 — CID 135001557
tert-butyl (4R)-4-[(S)-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 135001557) has the molecular formula C24H37NO7 and a molecular weight of 451.56 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(S)-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(S)-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 135001557 |
| Molecular Formula | C24H37NO7 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | tert-butyl (4R)-4-[(S)-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]([C@H](OCc2ccccc2)[C@@H]2OC(C)(C)O[C@H]2CO)COC1(C)C |
| InChI | InChI=1S/C24H37NO7/c1-22(2,3)32-21(27)25-17(15-29-23(25,4)5)19(28-14-16-11-9-8-10-12-16)20-18(13-26)30-24(6,7)31-20/h8-12,17-20,26H,13-15H2,1-7H3/t17-,18+,19+,20-/m1/s1 |
| InChIKey | FVFYXHRQWAUMQR-FUMNGEBKSA-N |
| XLogP | 3.46 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |