C29H41NO4 — CID 15119747
(3R,4R,4aS)-4-methyl-3-[(E,3R)-3-methyl-6-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-5-en-1-ynyl]-4-phenylmethoxy-1,3,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazine (PubChem CID 15119747) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is (3R,4R,4aS)-4-methyl-3-[(E,3R)-3-methyl-6-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-5-en-1-ynyl]-4-phenylmethoxy-1,3,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazine.
| Compound Name | (3R,4R,4aS)-4-methyl-3-[(E,3R)-3-methyl-6-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-5-en-1-ynyl]-4-phenylmethoxy-1,3,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazine |
|---|---|
| PubChem CID | 15119747 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | (3R,4R,4aS)-4-methyl-3-[(E,3R)-3-methyl-6-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-5-en-1-ynyl]-4-phenylmethoxy-1,3,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazine |
| SMILES | C/C(=C\C[C@@H](C)C#C[C@H]1OCN2CCC[C@H]2[C@@]1(C)OCc1ccccc1)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C29H41NO4/c1-21(14-16-22(2)27-23(3)33-28(4,5)34-27)15-17-26-29(6,25-13-10-18-30(25)20-31-26)32-19-24-11-8-7-9-12-24/h7-9,11-12,16,21,23,25-27H,10,13-14,18-20H2,1-6H3/b22-16+/t21-,23-,25+,26-,27-,29-/m1/s1 |
| InChIKey | VLEFFCWMNOZXBN-DQWBRSCBSA-N |
| XLogP | 5.30 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|