C16H19F2NO3 — CID 129013542
1-(2,4-difluorophenyl)-3-methylspiro[1,3,5,6,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-7,2'-1,3-dioxolane] (PubChem CID 129013542) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-methylspiro[1,3,5,6,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-7,2'-1,3-dioxolane].
| Compound Name | 1-(2,4-difluorophenyl)-3-methylspiro[1,3,5,6,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-7,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 129013542 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-methylspiro[1,3,5,6,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-7,2'-1,3-dioxolane] |
| SMILES | CC1OC(c2ccc(F)cc2F)C2CC3(CCN12)OCCO3 |
| InChI | InChI=1S/C16H19F2NO3/c1-10-19-5-4-16(20-6-7-21-16)9-14(19)15(22-10)12-3-2-11(17)8-13(12)18/h2-3,8,10,14-15H,4-7,9H2,1H3 |
| InChIKey | LWMIOKLEEOHBNH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |