C14H17F2NO3 — CID 16782593
7-(2,4-difluorophenoxy)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 16782593) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 7-(2,4-difluorophenoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | 7-(2,4-difluorophenoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 16782593 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 7-(2,4-difluorophenoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | NC1CCC2(CC1Oc1ccc(F)cc1F)OCCO2 |
| InChI | InChI=1S/C14H17F2NO3/c15-9-1-2-12(10(16)7-9)20-13-8-14(4-3-11(13)17)18-5-6-19-14/h1-2,7,11,13H,3-6,8,17H2 |
| InChIKey | MRUFUPCUPKGHGH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |