C13H23NO3 — CID 106200696
7-(2-cyclopropylethoxy)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 106200696) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 7-(2-cyclopropylethoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | 7-(2-cyclopropylethoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 106200696 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 7-(2-cyclopropylethoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | NC1CCC2(CC1OCCC1CC1)OCCO2 |
| InChI | InChI=1S/C13H23NO3/c14-11-3-5-13(16-7-8-17-13)9-12(11)15-6-4-10-1-2-10/h10-12H,1-9,14H2 |
| InChIKey | OIGFRPFEQNCQTB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |