About (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid
(7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid (PubChem CID 87436012) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid.
Analyze (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
The IUPAC name of (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid (CID 87436012) is (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid.
What is the SMILES notation for (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
The canonical SMILES for (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid is N[C@H]1CCC2(C[C@H]1C(=O)O)OCCO2.
What is the InChIKey of (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
The InChIKey is GVFSEJWLXADZGO-RQJHMYQMSA-N. The full InChI is InChI=1S/C9H15NO4/c10-7-1-2-9(13-3-4-14-9)5-6(7)8(11)12/h6-7H,1-5,10H2,(H,11,12)/t6-,7+/m1/s1.
What are the key properties of (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
(7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid has a molecular weight of 201.22 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylic acid is sourced from PubChem (CID 87436012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).