About (8R)-1,4-dioxaspiro[4.4]nonan-8-amine
(8R)-1,4-dioxaspiro[4.4]nonan-8-amine (PubChem CID 95431886) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is (8R)-1,4-dioxaspiro[4.4]nonan-8-amine.
Molecular Properties
| Compound Name | (8R)-1,4-dioxaspiro[4.4]nonan-8-amine |
| PubChem CID | 95431886 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (8R)-1,4-dioxaspiro[4.4]nonan-8-amine |
| SMILES | N[C@@H]1CCC2(C1)OCCO2 |
| InChI | InChI=1S/C7H13NO2/c8-6-1-2-7(5-6)9-3-4-10-7/h6H,1-5,8H2/t6-/m1/s1 |
| InChIKey | FTUCRLHGAZBPBK-ZCFIWIBFSA-N |
| XLogP | 0.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8R)-1,4-dioxaspiro[4.4]nonan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-1,4-dioxaspiro[4.4]nonan-8-amine?
The IUPAC name of (8R)-1,4-dioxaspiro[4.4]nonan-8-amine (CID 95431886) is (8R)-1,4-dioxaspiro[4.4]nonan-8-amine.
What is the SMILES notation for (8R)-1,4-dioxaspiro[4.4]nonan-8-amine?
The canonical SMILES for (8R)-1,4-dioxaspiro[4.4]nonan-8-amine is N[C@@H]1CCC2(C1)OCCO2.
What is the InChIKey of (8R)-1,4-dioxaspiro[4.4]nonan-8-amine?
The InChIKey is FTUCRLHGAZBPBK-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13NO2/c8-6-1-2-7(5-6)9-3-4-10-7/h6H,1-5,8H2/t6-/m1/s1.
What are the key properties of (8R)-1,4-dioxaspiro[4.4]nonan-8-amine?
(8R)-1,4-dioxaspiro[4.4]nonan-8-amine has a molecular weight of 143.19 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-1,4-dioxaspiro[4.4]nonan-8-amine is sourced from PubChem (CID 95431886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).