C8H13IO2 — CID 67237087
(8S)-8-(iodomethyl)-1,4-dioxaspiro[4.4]nonane (PubChem CID 67237087) has the molecular formula C8H13IO2 and a molecular weight of 268.09 g/mol. Its IUPAC name is (8S)-8-(iodomethyl)-1,4-dioxaspiro[4.4]nonane.
| Compound Name | (8S)-8-(iodomethyl)-1,4-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 67237087 |
| Molecular Formula | C8H13IO2 |
| Molecular Weight | 268.09 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | (8S)-8-(iodomethyl)-1,4-dioxaspiro[4.4]nonane |
| SMILES | IC[C@H]1CCC2(C1)OCCO2 |
| InChI | InChI=1S/C8H13IO2/c9-6-7-1-2-8(5-7)10-3-4-11-8/h7H,1-6H2/t7-/m0/s1 |
| InChIKey | JSKRZDVZAALDJE-ZETCQYMHSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.09 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|