About 8-methyl-1,4-dioxaspiro[4.4]nonane
8-methyl-1,4-dioxaspiro[4.4]nonane (PubChem CID 86135239) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 8-methyl-1,4-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 8-methyl-1,4-dioxaspiro[4.4]nonane |
| PubChem CID | 86135239 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 8-methyl-1,4-dioxaspiro[4.4]nonane |
| SMILES | CC1CCC2(C1)OCCO2 |
| InChI | InChI=1S/C8H14O2/c1-7-2-3-8(6-7)9-4-5-10-8/h7H,2-6H2,1H3 |
| InChIKey | ACOFEXDORZQHIM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-1,4-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,4-dioxaspiro[4.4]nonane?
The IUPAC name of 8-methyl-1,4-dioxaspiro[4.4]nonane (CID 86135239) is 8-methyl-1,4-dioxaspiro[4.4]nonane.
What is the SMILES notation for 8-methyl-1,4-dioxaspiro[4.4]nonane?
The canonical SMILES for 8-methyl-1,4-dioxaspiro[4.4]nonane is CC1CCC2(C1)OCCO2.
What is the InChIKey of 8-methyl-1,4-dioxaspiro[4.4]nonane?
The InChIKey is ACOFEXDORZQHIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-7-2-3-8(6-7)9-4-5-10-8/h7H,2-6H2,1H3.
What are the key properties of 8-methyl-1,4-dioxaspiro[4.4]nonane?
8-methyl-1,4-dioxaspiro[4.4]nonane has a molecular weight of 142.20 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,4-dioxaspiro[4.4]nonane is sourced from PubChem (CID 86135239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).