C16H21NO6S — CID 87436014
(4-methylphenyl)sulfonyl (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylate (PubChem CID 87436014) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylate.
| Compound Name | (4-methylphenyl)sulfonyl (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 87436014 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (4-methylphenyl)sulfonyl (7R,8S)-8-amino-1,4-dioxaspiro[4.5]decane-7-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=O)[C@@H]2CC3(CC[C@@H]2N)OCCO3)cc1 |
| InChI | InChI=1S/C16H21NO6S/c1-11-2-4-12(5-3-11)24(19,20)23-15(18)13-10-16(7-6-14(13)17)21-8-9-22-16/h2-5,13-14H,6-10,17H2,1H3/t13-,14+/m1/s1 |
| InChIKey | SYKCJJZHKIYZLZ-KGLIPLIRSA-N |
| XLogP | 1.10 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|