C19H26O7S — CID 19849036
ethyl 2-[3-[(4-methylphenyl)sulfonyloxymethyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate (PubChem CID 19849036) has the molecular formula C19H26O7S and a molecular weight of 398.48 g/mol. Its IUPAC name is ethyl 2-[3-[(4-methylphenyl)sulfonyloxymethyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate.
| Compound Name | ethyl 2-[3-[(4-methylphenyl)sulfonyloxymethyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate |
|---|---|
| PubChem CID | 19849036 |
| Molecular Formula | C19H26O7S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | ethyl 2-[3-[(4-methylphenyl)sulfonyloxymethyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate |
| SMILES | CCOC(=O)CC1CCC2(C1)OCC(COS(=O)(=O)c1ccc(C)cc1)O2 |
| InChI | InChI=1S/C19H26O7S/c1-3-23-18(20)10-15-8-9-19(11-15)24-12-16(26-19)13-25-27(21,22)17-6-4-14(2)5-7-17/h4-7,15-16H,3,8-13H2,1-2H3 |
| InChIKey | BTVCAFJEIJOTCP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|