C18H19NO5S — CID 10406284
spiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-quinoline]-2'-yl 4-methylbenzenesulfonate (PubChem CID 10406284) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-quinoline]-2'-yl 4-methylbenzenesulfonate.
| Compound Name | spiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-quinoline]-2'-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10406284 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | spiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-quinoline]-2'-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3c(n2)CCC2(C3)OCCO2)cc1 |
| InChI | InChI=1S/C18H19NO5S/c1-13-2-5-15(6-3-13)25(20,21)24-17-7-4-14-12-18(22-10-11-23-18)9-8-16(14)19-17/h2-7H,8-12H2,1H3 |
| InChIKey | FXMUDMMSNXYSKT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|