About (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate
(7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate (PubChem CID 86674768) has the molecular formula C12H14F3NO3S
and a molecular weight of 309.31 g/mol. Its IUPAC name is (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate |
| PubChem CID | 86674768 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)CCc2ccc(OS(=O)(=O)C(F)(F)F)nc2C1 |
| InChI | InChI=1S/C12H14F3NO3S/c1-11(2)6-5-8-3-4-10(16-9(8)7-11)19-20(17,18)12(13,14)15/h3-4H,5-7H2,1-2H3 |
| InChIKey | JQULETLRLORONN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate?
The IUPAC name of (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate (CID 86674768) is (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate.
What is the SMILES notation for (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate?
The canonical SMILES for (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate is CC1(C)CCc2ccc(OS(=O)(=O)C(F)(F)F)nc2C1.
What is the InChIKey of (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate?
The InChIKey is JQULETLRLORONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3NO3S/c1-11(2)6-5-8-3-4-10(16-9(8)7-11)19-20(17,18)12(13,14)15/h3-4H,5-7H2,1-2H3.
What are the key properties of (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate?
(7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate has a molecular weight of 309.31 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7,7-dimethyl-6,8-dihydro-5H-quinolin-2-yl) trifluoromethanesulfonate is sourced from PubChem (CID 86674768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).