C29H19F3N2O3S — CID 118104355
[5,6-bis(4-phenylphenyl)pyrazin-2-yl] trifluoromethanesulfonate (PubChem CID 118104355) has the molecular formula C29H19F3N2O3S and a molecular weight of 532.54 g/mol. Its IUPAC name is [5,6-bis(4-phenylphenyl)pyrazin-2-yl] trifluoromethanesulfonate.
| Compound Name | [5,6-bis(4-phenylphenyl)pyrazin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118104355 |
| Molecular Formula | C29H19F3N2O3S |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | [5,6-bis(4-phenylphenyl)pyrazin-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cnc(-c2ccc(-c3ccccc3)cc2)c(-c2ccc(-c3ccccc3)cc2)n1)C(F)(F)F |
| InChI | InChI=1S/C29H19F3N2O3S/c30-29(31,32)38(35,36)37-26-19-33-27(24-15-11-22(12-16-24)20-7-3-1-4-8-20)28(34-26)25-17-13-23(14-18-25)21-9-5-2-6-10-21/h1-19H |
| InChIKey | PPCDQJSWTYTHOF-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|