C16H22F2N2O5S — CID 89260936
tert-butyl 2-(1,1-difluoroethylsulfonyloxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate (PubChem CID 89260936) has the molecular formula C16H22F2N2O5S and a molecular weight of 392.42 g/mol. Its IUPAC name is tert-butyl 2-(1,1-difluoroethylsulfonyloxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate.
| Compound Name | tert-butyl 2-(1,1-difluoroethylsulfonyloxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 89260936 |
| Molecular Formula | C16H22F2N2O5S |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | tert-butyl 2-(1,1-difluoroethylsulfonyloxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(OS(=O)(=O)C(C)(F)F)nc2CC1 |
| InChI | InChI=1S/C16H22F2N2O5S/c1-15(2,3)24-14(21)20-9-7-11-5-6-13(19-12(11)8-10-20)25-26(22,23)16(4,17)18/h5-6H,7-10H2,1-4H3 |
| InChIKey | HZWWCKCAMPAKTH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|