C7H11F2NO2 — CID 83854797
2-amino-5,5-difluorocyclohexane-1-carboxylic acid (PubChem CID 83854797) has the molecular formula C7H11F2NO2 and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-amino-5,5-difluorocyclohexane-1-carboxylic acid.
| Compound Name | 2-amino-5,5-difluorocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 83854797 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-amino-5,5-difluorocyclohexane-1-carboxylic acid |
| SMILES | NC1CCC(F)(F)CC1C(=O)O |
| InChI | InChI=1S/C7H11F2NO2/c8-7(9)2-1-5(10)4(3-7)6(11)12/h4-5H,1-3,10H2,(H,11,12) |
| InChIKey | RSVAIHOCCKHLPE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |