About 2-amino-5,5-difluorocyclohexane-1-carboxylic acid
2-amino-5,5-difluorocyclohexane-1-carboxylic acid (PubChem CID 83854797) has the molecular formula C7H11F2NO2
and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-amino-5,5-difluorocyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-5,5-difluorocyclohexane-1-carboxylic acid |
| PubChem CID | 83854797 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-amino-5,5-difluorocyclohexane-1-carboxylic acid |
| SMILES | NC1CCC(F)(F)CC1C(=O)O |
| InChI | InChI=1S/C7H11F2NO2/c8-7(9)2-1-5(10)4(3-7)6(11)12/h4-5H,1-3,10H2,(H,11,12) |
| InChIKey | RSVAIHOCCKHLPE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-5,5-difluorocyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5,5-difluorocyclohexane-1-carboxylic acid?
The IUPAC name of 2-amino-5,5-difluorocyclohexane-1-carboxylic acid (CID 83854797) is 2-amino-5,5-difluorocyclohexane-1-carboxylic acid.
What is the SMILES notation for 2-amino-5,5-difluorocyclohexane-1-carboxylic acid?
The canonical SMILES for 2-amino-5,5-difluorocyclohexane-1-carboxylic acid is NC1CCC(F)(F)CC1C(=O)O.
What is the InChIKey of 2-amino-5,5-difluorocyclohexane-1-carboxylic acid?
The InChIKey is RSVAIHOCCKHLPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO2/c8-7(9)2-1-5(10)4(3-7)6(11)12/h4-5H,1-3,10H2,(H,11,12).
What are the key properties of 2-amino-5,5-difluorocyclohexane-1-carboxylic acid?
2-amino-5,5-difluorocyclohexane-1-carboxylic acid has a molecular weight of 179.17 g/mol, XLogP of 0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,5-difluorocyclohexane-1-carboxylic acid is sourced from PubChem (CID 83854797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).