C9H8F2O2 — CID 57033159
3-(2,4-difluorophenyl)-2-methyloxiran-2-ol (PubChem CID 57033159) has the molecular formula C9H8F2O2 and a molecular weight of 186.16 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-2-methyloxiran-2-ol.
| Compound Name | 3-(2,4-difluorophenyl)-2-methyloxiran-2-ol |
|---|---|
| PubChem CID | 57033159 |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-(2,4-difluorophenyl)-2-methyloxiran-2-ol |
| SMILES | CC1(O)OC1c1ccc(F)cc1F |
| InChI | InChI=1S/C9H8F2O2/c1-9(12)8(13-9)6-3-2-5(10)4-7(6)11/h2-4,8,12H,1H3 |
| InChIKey | VADMHIDBENVTKN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|