C14H18F2O — CID 106663829
1-(2,4-difluorophenyl)-2,4,4-trimethylcyclopentan-1-ol (PubChem CID 106663829) has the molecular formula C14H18F2O and a molecular weight of 240.29 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2,4,4-trimethylcyclopentan-1-ol.
| Compound Name | 1-(2,4-difluorophenyl)-2,4,4-trimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 106663829 |
| Molecular Formula | C14H18F2O |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2,4,4-trimethylcyclopentan-1-ol |
| SMILES | CC1CC(C)(C)CC1(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H18F2O/c1-9-7-13(2,3)8-14(9,17)11-5-4-10(15)6-12(11)16/h4-6,9,17H,7-8H2,1-3H3 |
| InChIKey | HIUFTYHXMPLVRK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |