C15H19F3O2 — CID 106663685
2,4,4-trimethyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol (PubChem CID 106663685) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2,4,4-trimethyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol.
| Compound Name | 2,4,4-trimethyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 106663685 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2,4,4-trimethyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol |
| SMILES | CC1CC(C)(C)CC1(O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H19F3O2/c1-10-8-13(2,3)9-14(10,19)11-6-4-5-7-12(11)20-15(16,17)18/h4-7,10,19H,8-9H2,1-3H3 |
| InChIKey | SHJWUFRCFYMQEH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |